![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/script.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 833C_linear_amplifier/ | 06-May-2013 20:34 | - | |
| 2008extra diagrams.pdf | 11-Jul-2010 03:13 | 217K | |
| AMANDX longwave broadcast stations.html | 22-Jul-2010 03:40 | 11K | |
| AMANDX longwave broadcast stations_files/ | 22-Jul-2010 03:40 | - | |
| AR-Cluster User Manual.pdf | 11-Jul-2010 04:26 | 718K | |
| ARRL Ham Bands.pdf | 11-Jul-2010 04:25 | 341K | |
| Amateur_Radio_US_Grid_Square_Map.pdf | 11-Jul-2010 04:26 | 901K | |
| Bencher Keyer copy made for WW8N in 1981/ | 22-Feb-2012 00:36 | - | |
| Binocular core power vs temp test/ | 02-Feb-2012 13:36 | - | |
| CQRLogScreenshot.png | 31-Jul-2012 19:17 | 105K | |
| Cockaday_antiqueAM/ | 16-Sep-2011 17:18 | - | |
| Common Mode Chokes W1HIS 2006 Apr 06.pdf | 11-Jul-2010 04:45 | 1.9M | |
| D-104_microphone_element/ | 16-Jun-2012 14:10 | - | |
| D104_Pot_position.jpg | 14-Nov-2010 19:23 | 775K | |
| DCP-2 Dual Controller-Phaser.pdf | 11-Jul-2010 04:35 | 336K | |
| DXP-6-L.pdf | 11-Jul-2010 04:46 | 675K | |
| DesigningPCB-LPs.pdf | 11-Jul-2010 07:19 | 17K | |
| Dynamic_Range_Data.pdf | 11-Jul-2010 03:18 | 65K | |
| Frequency Allocation chart.pdf | 11-Jul-2010 04:47 | 94K | |
| Gates_rotary_inductor/ | 21-Sep-2010 17:36 | - | |
| Gates plate choke.jpg | 16-Oct-2010 01:29 | 243K | |
| HFE0204_Sevick.pdf | 11-Jul-2010 04:48 | 208K | |
| Hambands_color[1].pdf | 11-Jul-2010 03:19 | 208K | |
| Icom/ | 06-Feb-2011 22:39 | - | |
| KochMorseTrainer Install.exe | 11-Jul-2010 04:09 | 955K | |
| Lightning Protection for Ham Radio Stations.pdf | 11-Jul-2010 05:14 | 766K | |
| Lightning_Primer_1.pdf | 11-Jul-2010 05:15 | 49K | |
| Linear amp GS35B HF-6m.jpg | 11-Jul-2010 04:11 | 95K | |
| MFJ-941C.pdf | 11-Jul-2010 05:22 | 92K | |
| MW And LW Noise Reducing Antennas II.pdf | 11-Jul-2010 05:25 | 620K | |
| N_plugs/ | 16-Nov-2010 15:50 | - | |
| Ohm'sLaw.gif | 11-Jul-2010 04:11 | 10K | |
| Omron MY4 relay datasheet.pdf | 11-Jul-2010 03:20 | 113K | |
| Powerstat/ | 23-Mar-2011 00:24 | - | |
| Present-dayReceivers-sm.pdf | 11-Jul-2010 03:36 | 1.6M | |
| QST_Nov_1987_p33-35.pdf | 11-Jul-2010 05:59 | 1.1M | |
| R.F._Grounding_primer_2.pdf | 11-Jul-2010 05:56 | 39K | |
| RFI-Ham.pdf | 11-Jul-2010 06:14 | 2.3M | |
| RFS-Rev2.pdf | 11-Jul-2010 06:14 | 1.7M | |
| RLS-2 Rev2.pdf | 11-Jul-2010 06:06 | 388K | |
| SB-200/ | 09-Feb-2012 12:47 | - | |
| Shop_Station/ | 09-Feb-2012 13:11 | - | |
| Synchronous Noise Blankers Revisted.pdf | 11-Jul-2010 06:14 | 26K | |
| TX_via_Soundcard.pdf | 11-Jul-2010 06:20 | 363K | |
| The Art and Skill of Radio-Telegraphy 3rd edition 4-02-1.pdf | 11-Jul-2010 06:20 | 939K | |
| TraskTLTTutorial.pdf | 11-Jul-2010 06:18 | 54K | |
| VHF_distance_nomograph.zip | 30-Jul-2011 02:01 | 1.5M | |
| W0BTU2.JPG | 19-Aug-2010 22:47 | 241K | |
| W0BTU Audio Clipper/ | 12-Feb-2011 13:41 | - | |
| W0BTU_2_meter_linear/ | 10-Jul-2011 22:04 | - | |
| W0BTU station console/ | 02-Aug-2012 17:15 | - | |
| W7IUV_Low_Band_Preamp.pdf | 11-Jul-2010 00:58 | 325K | |
| W8BIM's Rig.pdf | 26-Aug-2010 23:47 | 1.0M | |
| W8WWV08.pdf | 11-Jul-2010 08:45 | 1.6M | |
| Yes-All My Coax Cables Are 75 Ohms.pdf | 11-Jul-2010 08:45 | 84K | |
| allochrt.pdf | 11-Jul-2010 03:12 | 94K | |
| amp_rack/ | 01-Jan-2013 21:11 | - | |
| ch13.pps | 11-Jul-2010 04:14 | 1.5M | |
| cqrlog-w0btu.txt | 29-Jul-2012 15:49 | 5.6K | |
| electromagnetic_spectrum.png | 19-Aug-2010 22:46 | 256K | |
| eznec.sh | 11-Jul-2010 04:11 | 239 | |
| fast TR relay.pdf | 11-Jul-2010 04:46 | 8.0K | |
| fastrely.pdf | 11-Jul-2010 07:20 | 8.0K | |
| fig_2.jpg | 11-Jul-2010 04:46 | 17K | |
| ground_parameter_measurements_2.pdf | 11-Jul-2010 07:26 | 1.0M | |
| intro_itt_ref_4.pdf | 11-Jul-2010 08:01 | 133K | |
| itt_ref_4.pdf | 11-Jul-2010 09:04 | 13M | |
| mfj-1025_1026.htm | 11-Jul-2010 01:11 | 19K | |
| preamp-Cookbook.pdf | 11-Jul-2010 08:34 | 2.7M | |
| private/ | 21-Mar-2011 18:13 | - | |
| qr_img.php.png | 11-Jul-2010 04:11 | 435 | |
| qr_img3.png | 11-Jul-2010 04:11 | 359 | |
| qx11carcia.pdf | 11-Jul-2010 05:56 | 383K | |
| sb200eng.htm | 11-Jul-2010 01:14 | 73K | |
| software/ | 12-Aug-2010 15:36 | - | |
| tubes/ | 18-Mar-2012 00:30 | - | |
| w0btu.jpeg | 19-Aug-2010 22:46 | 38K | |
| w0btu.jpg | 19-Aug-2010 22:46 | 25K | |
